C21H27N5O — CID 172902381
N-[4-[[4-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenyl]acetamide (PubChem CID 172902381) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[4-[[4-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 172902381 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[4-[[4-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC(Nc3ccnc(C4CC4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O/c1-15(27)23-18-6-2-16(3-7-18)14-26-12-9-19(10-13-26)24-20-8-11-22-21(25-20)17-4-5-17/h2-3,6-8,11,17,19H,4-5,9-10,12-14H2,1H3,(H,23,27)(H,22,24,25) |
| InChIKey | LVJXSPQCOAKIGN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |