C15H16ClN5O2 — CID 95901073
N-[(3R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-3-yl]-5-nitropyridin-2-amine (PubChem CID 95901073) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is N-[(3R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-3-yl]-5-nitropyridin-2-amine.
| Compound Name | N-[(3R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-3-yl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 95901073 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-[(3R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidin-3-yl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N[C@@H]2CCN(Cc3ccnc(Cl)c3)C2)nc1 |
| InChI | InChI=1S/C15H16ClN5O2/c16-14-7-11(3-5-17-14)9-20-6-4-12(10-20)19-15-2-1-13(8-18-15)21(22)23/h1-3,5,7-8,12H,4,6,9-10H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | BYCARQNGDIKMPO-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|