C20H20F3N5 — CID 172904403
4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]-3-(trifluoromethyl)benzonitrile (PubChem CID 172904403) has the molecular formula C20H20F3N5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 172904403 |
| Molecular Formula | C20H20F3N5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[3-[(2-cyclopropylpyrimidin-4-yl)amino]piperidin-1-yl]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCC(Nc3ccnc(C4CC4)n3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3N5/c21-20(22,23)16-10-13(11-24)3-6-17(16)28-9-1-2-15(12-28)26-18-7-8-25-19(27-18)14-4-5-14/h3,6-8,10,14-15H,1-2,4-5,9,12H2,(H,25,26,27) |
| InChIKey | KODKVWYGAQNXTB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |