C20H19NO4 — CID 172905265
6-methoxy-1-oxo-N-(2,4,6-trimethylphenyl)isochromene-3-carboxamide (PubChem CID 172905265) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-methoxy-1-oxo-N-(2,4,6-trimethylphenyl)isochromene-3-carboxamide.
| Compound Name | 6-methoxy-1-oxo-N-(2,4,6-trimethylphenyl)isochromene-3-carboxamide |
|---|---|
| PubChem CID | 172905265 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-methoxy-1-oxo-N-(2,4,6-trimethylphenyl)isochromene-3-carboxamide |
| SMILES | COc1ccc2c(=O)oc(C(=O)Nc3c(C)cc(C)cc3C)cc2c1 |
| InChI | InChI=1S/C20H19NO4/c1-11-7-12(2)18(13(3)8-11)21-19(22)17-10-14-9-15(24-4)5-6-16(14)20(23)25-17/h5-10H,1-4H3,(H,21,22) |
| InChIKey | RCSQKKHZFOMOJS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |