C19H14F3NO5 — CID 175652128
6-methoxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]-1-oxoisochromene-3-carboxamide (PubChem CID 175652128) has the molecular formula C19H14F3NO5 and a molecular weight of 393.32 g/mol. Its IUPAC name is 6-methoxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]-1-oxoisochromene-3-carboxamide.
| Compound Name | 6-methoxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 175652128 |
| Molecular Formula | C19H14F3NO5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 6-methoxy-N-[2-methoxy-5-(trifluoromethyl)phenyl]-1-oxoisochromene-3-carboxamide |
| SMILES | COc1ccc2c(=O)oc(C(=O)Nc3cc(C(F)(F)F)ccc3OC)cc2c1 |
| InChI | InChI=1S/C19H14F3NO5/c1-26-12-4-5-13-10(7-12)8-16(28-18(13)25)17(24)23-14-9-11(19(20,21)22)3-6-15(14)27-2/h3-9H,1-2H3,(H,23,24) |
| InChIKey | AYBPZFRLKONJJZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |