C10H12N4O3S — CID 172906645
2-methoxy-4-methyl-N-(1,2,4-triazol-4-yl)benzenesulfonamide (PubChem CID 172906645) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-methoxy-4-methyl-N-(1,2,4-triazol-4-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-4-methyl-N-(1,2,4-triazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 172906645 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-methoxy-4-methyl-N-(1,2,4-triazol-4-yl)benzenesulfonamide |
| SMILES | COc1cc(C)ccc1S(=O)(=O)Nn1cnnc1 |
| InChI | InChI=1S/C10H12N4O3S/c1-8-3-4-10(9(5-8)17-2)18(15,16)13-14-6-11-12-7-14/h3-7,13H,1-2H3 |
| InChIKey | PRNFJADJAXRFMI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |