C15H22N4O4S — CID 131938285
2-methoxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 131938285) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 131938285 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-methoxy-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | COCCCn1cnnc1CNS(=O)(=O)c1ccc(C)cc1OC |
| InChI | InChI=1S/C15H22N4O4S/c1-12-5-6-14(13(9-12)23-3)24(20,21)17-10-15-18-16-11-19(15)7-4-8-22-2/h5-6,9,11,17H,4,7-8,10H2,1-3H3 |
| InChIKey | SAUQWXLBFPSLFP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|