C26H25OP — CID 172908374
(2R,3S)-4-anthracen-9-yl-3-tert-butyl-2-methyl-2H-1,3-benzoxaphosphole (PubChem CID 172908374) has the molecular formula C26H25OP and a molecular weight of 384.46 g/mol. Its IUPAC name is (2R,3S)-4-anthracen-9-yl-3-tert-butyl-2-methyl-2H-1,3-benzoxaphosphole.
| Compound Name | (2R,3S)-4-anthracen-9-yl-3-tert-butyl-2-methyl-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 172908374 |
| Molecular Formula | C26H25OP |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2R,3S)-4-anthracen-9-yl-3-tert-butyl-2-methyl-2H-1,3-benzoxaphosphole |
| SMILES | C[C@@H]1Oc2cccc(-c3c4ccccc4cc4ccccc34)c2[P@]1C(C)(C)C |
| InChI | InChI=1S/C26H25OP/c1-17-27-23-15-9-14-22(25(23)28(17)26(2,3)4)24-20-12-7-5-10-18(20)16-19-11-6-8-13-21(19)24/h5-17H,1-4H3/t17-,28-/m1/s1 |
| InChIKey | YOXUHULUPBYLBU-JYRCXFKTSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|