C28H31O3P — CID 177440894
(2R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-2H-1,3-benzoxaphosphole (PubChem CID 177440894) has the molecular formula C28H31O3P and a molecular weight of 446.53 g/mol. Its IUPAC name is (2R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-2H-1,3-benzoxaphosphole.
| Compound Name | (2R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 177440894 |
| Molecular Formula | C28H31O3P |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2R)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-2H-1,3-benzoxaphosphole |
| SMILES | COc1cccc(OC)c1-c1cccc2c1P(C(C)(C)C)[C@H](C/C=C/c1ccccc1)O2 |
| InChI | InChI=1S/C28H31O3P/c1-28(2,3)32-25(19-9-14-20-12-7-6-8-13-20)31-24-18-10-15-21(27(24)32)26-22(29-4)16-11-17-23(26)30-5/h6-18,25H,19H2,1-5H3/b14-9+/t25-,32?/m1/s1 |
| InChIKey | SIFWCDVOJZROCA-RFFXGZTHSA-N |
| XLogP | 7.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|