C27H40O4P2 — CID 156596985
(2S,3S)-3-tert-butyl-2-ditert-butylphosphoryl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole (PubChem CID 156596985) has the molecular formula C27H40O4P2 and a molecular weight of 490.56 g/mol. Its IUPAC name is (2S,3S)-3-tert-butyl-2-ditert-butylphosphoryl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole.
| Compound Name | (2S,3S)-3-tert-butyl-2-ditert-butylphosphoryl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 156596985 |
| Molecular Formula | C27H40O4P2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (2S,3S)-3-tert-butyl-2-ditert-butylphosphoryl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
| SMILES | COc1cccc(OC)c1-c1cccc2c1[P@](C(C)(C)C)[C@@H](P(=O)(C(C)(C)C)C(C)(C)C)O2 |
| InChI | InChI=1S/C27H40O4P2/c1-25(2,3)32-23-18(22-19(29-10)15-13-16-20(22)30-11)14-12-17-21(23)31-24(32)33(28,26(4,5)6)27(7,8)9/h12-17,24H,1-11H3/t24-,32-/m0/s1 |
| InChIKey | FOFSIWINXJCDGO-BNHRFMORSA-N |
| XLogP | 7.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|