C26H29O3P — CID 155887923
(3R)-2-benzyl-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole (PubChem CID 155887923) has the molecular formula C26H29O3P and a molecular weight of 420.49 g/mol. Its IUPAC name is (3R)-2-benzyl-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole.
| Compound Name | (3R)-2-benzyl-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 155887923 |
| Molecular Formula | C26H29O3P |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (3R)-2-benzyl-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
| SMILES | COc1cccc(OC)c1-c1cccc2c1[P@@](C(C)(C)C)C(Cc1ccccc1)O2 |
| InChI | InChI=1S/C26H29O3P/c1-26(2,3)30-23(17-18-11-7-6-8-12-18)29-22-16-9-13-19(25(22)30)24-20(27-4)14-10-15-21(24)28-5/h6-16,23H,17H2,1-5H3/t23?,30-/m0/s1 |
| InChIKey | RVXDJSOXKFKIKD-POYPGSECSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|