C17H20NO2P — CID 172908361
2-[(2R,3S)-3-tert-butyl-4-methoxy-2H-1,3-benzoxaphosphol-2-yl]pyridine (PubChem CID 172908361) has the molecular formula C17H20NO2P and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[(2R,3S)-3-tert-butyl-4-methoxy-2H-1,3-benzoxaphosphol-2-yl]pyridine.
| Compound Name | 2-[(2R,3S)-3-tert-butyl-4-methoxy-2H-1,3-benzoxaphosphol-2-yl]pyridine |
|---|---|
| PubChem CID | 172908361 |
| Molecular Formula | C17H20NO2P |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[(2R,3S)-3-tert-butyl-4-methoxy-2H-1,3-benzoxaphosphol-2-yl]pyridine |
| SMILES | COc1cccc2c1[P@](C(C)(C)C)[C@H](c1ccccn1)O2 |
| InChI | InChI=1S/C17H20NO2P/c1-17(2,3)21-15-13(19-4)9-7-10-14(15)20-16(21)12-8-5-6-11-18-12/h5-11,16H,1-4H3/t16-,21+/m1/s1 |
| InChIKey | NFXZRUNTUSEVGQ-IERDGZPVSA-N |
| XLogP | 4.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|