C13H16ClN3O2 — CID 172908612
(3S)-1-[2-(2-chloro-3-pyridinyl)acetyl]piperidine-3-carboxamide (PubChem CID 172908612) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is (3S)-1-[2-(2-chloro-3-pyridinyl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(2-chloro-3-pyridinyl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 172908612 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3S)-1-[2-(2-chloro-3-pyridinyl)acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(C(=O)Cc2cccnc2Cl)C1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-12-9(3-1-5-16-12)7-11(18)17-6-2-4-10(8-17)13(15)19/h1,3,5,10H,2,4,6-8H2,(H2,15,19)/t10-/m0/s1 |
| InChIKey | MVRLSGDTKPBMCQ-JTQLQIEISA-N |
| XLogP | 1.00 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|