C15H17N3O2S — CID 172908629
(3S)-1-[2-(1,3-benzothiazol-7-yl)acetyl]piperidine-3-carboxamide (PubChem CID 172908629) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (3S)-1-[2-(1,3-benzothiazol-7-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(1,3-benzothiazol-7-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 172908629 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3S)-1-[2-(1,3-benzothiazol-7-yl)acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(C(=O)Cc2cccc3ncsc23)C1 |
| InChI | InChI=1S/C15H17N3O2S/c16-15(20)11-4-2-6-18(8-11)13(19)7-10-3-1-5-12-14(10)21-9-17-12/h1,3,5,9,11H,2,4,6-8H2,(H2,16,20)/t11-/m0/s1 |
| InChIKey | WGNHPXNYNNGWCO-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |