C17H21Cl2NO — CID 17290892
N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride (PubChem CID 17290892) has the molecular formula C17H21Cl2NO and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17290892 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1cccc(OCc2ccccc2Cl)c1.Cl |
| InChI | InChI=1S/C17H20ClNO.ClH/c1-2-10-19-12-14-6-5-8-16(11-14)20-13-15-7-3-4-9-17(15)18;/h3-9,11,19H,2,10,12-13H2,1H3;1H |
| InChIKey | DUTDIEAKQJZHKI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|