C18H23Cl2NO — CID 17291308
N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine;hydrochloride (PubChem CID 17291308) has the molecular formula C18H23Cl2NO and a molecular weight of 340.29 g/mol. Its IUPAC name is N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine;hydrochloride.
| Compound Name | N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291308 |
| Molecular Formula | C18H23Cl2NO |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[[3-[(2-chlorophenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine;hydrochloride |
| SMILES | CC(C)CNCc1cccc(OCc2ccccc2Cl)c1.Cl |
| InChI | InChI=1S/C18H22ClNO.ClH/c1-14(2)11-20-12-15-6-5-8-17(10-15)21-13-16-7-3-4-9-18(16)19;/h3-10,14,20H,11-13H2,1-2H3;1H |
| InChIKey | BBCXXJUAOBNOEF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |