C17H18N2O3 — CID 172909389
6-(1-cyclohexylpyrazol-4-yl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 172909389) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 6-(1-cyclohexylpyrazol-4-yl)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(1-cyclohexylpyrazol-4-yl)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 172909389 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-(1-cyclohexylpyrazol-4-yl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1-c1cnn(C3CCCCC3)c1)OCO2 |
| InChI | InChI=1S/C17H18N2O3/c20-10-12-6-16-17(22-11-21-16)7-15(12)13-8-18-19(9-13)14-4-2-1-3-5-14/h6-10,14H,1-5,11H2 |
| InChIKey | AAMGJCKCZOFLHM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|