C21H33N3O4S — CID 172910142
N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid (PubChem CID 172910142) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid |
|---|---|
| PubChem CID | 172910142 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-(cyclopropylmethoxy)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid |
| SMILES | CCc1nc(CN2C[C@H]3C[C@@H](NC(C)=O)[C@H](OCC4CC4)C[C@H]3C2)cs1.O=CO |
| InChI | InChI=1S/C20H31N3O2S.CH2O2/c1-3-20-22-17(12-26-20)10-23-8-15-6-18(21-13(2)24)19(7-16(15)9-23)25-11-14-4-5-14;2-1-3/h12,14-16,18-19H,3-11H2,1-2H3,(H,21,24);1H,(H,2,3)/t15-,16+,18-,19-;/m1./s1 |
| InChIKey | LYEJYQMWDNOLHM-LJBKODRFSA-N |
| XLogP | 2.55 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|