C18H24O7S — CID 172916299
(4S,6R,9S,10S)-9,10,16,18-tetrahydroxy-4-methyl-6-sulfanyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8-dione (PubChem CID 172916299) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is (4S,6R,9S,10S)-9,10,16,18-tetrahydroxy-4-methyl-6-sulfanyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8-dione.
| Compound Name | (4S,6R,9S,10S)-9,10,16,18-tetrahydroxy-4-methyl-6-sulfanyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8-dione |
|---|---|
| PubChem CID | 172916299 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4S,6R,9S,10S)-9,10,16,18-tetrahydroxy-4-methyl-6-sulfanyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8-dione |
| SMILES | C[C@H]1C[C@@H](S)CC(=O)[C@@H](O)[C@@H](O)CCCc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H24O7S/c1-9-5-12(26)8-15(22)17(23)13(20)4-2-3-10-6-11(19)7-14(21)16(10)18(24)25-9/h6-7,9,12-13,17,19-21,23,26H,2-5,8H2,1H3/t9-,12+,13-,17-/m0/s1 |
| InChIKey | YCFFKQYTPDCVHB-KMLDAGGKSA-N |
| XLogP | 1.35 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|