C21H22N6O6S3 — CID 172917650
7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[[3-(hydroxysulfanylamino)-5-methylphenyl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 172917650) has the molecular formula C21H22N6O6S3 and a molecular weight of 550.64 g/mol. Its IUPAC name is 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[[3-(hydroxysulfanylamino)-5-methylphenyl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[[3-(hydroxysulfanylamino)-5-methylphenyl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 172917650 |
| Molecular Formula | C21H22N6O6S3 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[[3-(hydroxysulfanylamino)-5-methylphenyl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(Cc3cc(C)cc(NSO)c3)CSC12)c1csc(N)n1 |
| InChI | InChI=1S/C21H22N6O6S3/c1-9-3-10(6-12(4-9)26-36-32)5-11-7-34-19-15(18(29)27(19)16(11)20(30)31)24-17(28)14(25-33-2)13-8-35-21(22)23-13/h3-4,6,8,15,19,26,32H,5,7H2,1-2H3,(H2,22,23)(H,24,28)(H,30,31)/b25-14- |
| InChIKey | MEWJDXQVGAJQSP-QFEZKATASA-N |
| XLogP | 1.90 |
| TPSA | 179.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|