C22H19F3N4O2S — CID 172919886
2-[2-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 172919886) has the molecular formula C22H19F3N4O2S and a molecular weight of 460.48 g/mol. Its IUPAC name is 2-[2-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 172919886 |
| Molecular Formula | C22H19F3N4O2S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[2-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1SC(=N/N=C2\CCCc3ccccc32)NC1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H19F3N4O2S/c23-22(24,25)15-9-3-4-10-17(15)26-19(30)12-18-20(31)27-21(32-18)29-28-16-11-5-7-13-6-1-2-8-14(13)16/h1-4,6,8-10,18H,5,7,11-12H2,(H,26,30)(H,27,29,31)/b28-16+ |
| InChIKey | ODWOLQNMRLYCNO-LQKURTRISA-N |
| XLogP | 4.36 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|