C21H30N8 — CID 172922162
4-[1-(3,4-dimethylpentanehydrazonoyl)-2-methylidene-4-pyridinyl]-N-(2-methylpyrazol-3-yl)-1,4-dihydropyrimidin-2-amine (PubChem CID 172922162) has the molecular formula C21H30N8 and a molecular weight of 394.53 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylpentanehydrazonoyl)-2-methylidene-4-pyridinyl]-N-(2-methylpyrazol-3-yl)-1,4-dihydropyrimidin-2-amine.
| Compound Name | 4-[1-(3,4-dimethylpentanehydrazonoyl)-2-methylidene-4-pyridinyl]-N-(2-methylpyrazol-3-yl)-1,4-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 172922162 |
| Molecular Formula | C21H30N8 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-[1-(3,4-dimethylpentanehydrazonoyl)-2-methylidene-4-pyridinyl]-N-(2-methylpyrazol-3-yl)-1,4-dihydropyrimidin-2-amine |
| SMILES | C=C1C=C(C2C=CNC(Nc3ccnn3C)=N2)C=CN1/C(CC(C)C(C)C)=N\N |
| InChI | InChI=1S/C21H30N8/c1-14(2)15(3)12-20(27-22)29-11-8-17(13-16(29)4)18-6-9-23-21(25-18)26-19-7-10-24-28(19)5/h6-11,13-15,18H,4,12,22H2,1-3,5H3,(H2,23,25,26)/b27-20- |
| InChIKey | WSMALUUOBXLVIT-OOAXWGSJSA-N |
| XLogP | 2.90 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|