C22H30N4O3S — CID 172925029
methyl (2E)-2-[(2Z)-2-[[2-[(dibutylamino)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925029) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[2-[(dibutylamino)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[2-[(dibutylamino)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925029 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[2-[(dibutylamino)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCCCN(CCCC)Cc1ccccc1C=N/N=C1/NC(=O)/C(=C\C(=O)OC)S1 |
| InChI | InChI=1S/C22H30N4O3S/c1-4-6-12-26(13-7-5-2)16-18-11-9-8-10-17(18)15-23-25-22-24-21(28)19(30-22)14-20(27)29-3/h8-11,14-15H,4-7,12-13,16H2,1-3H3,(H,24,25,28)/b19-14+,23-15? |
| InChIKey | BQUUXCGCNGNXKR-NPMICWIVSA-N |
| XLogP | 3.70 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|