C10H20N2O — CID 172929554
methyl (NE,1Z)-3-methyl-N-(2-methylpropylidene)butanehydrazonate (PubChem CID 172929554) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is methyl (NE,1Z)-3-methyl-N-(2-methylpropylidene)butanehydrazonate.
| Compound Name | methyl (NE,1Z)-3-methyl-N-(2-methylpropylidene)butanehydrazonate |
|---|---|
| PubChem CID | 172929554 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | methyl (NE,1Z)-3-methyl-N-(2-methylpropylidene)butanehydrazonate |
| SMILES | CO/C(CC(C)C)=N\N=C\C(C)C |
| InChI | InChI=1S/C10H20N2O/c1-8(2)6-10(13-5)12-11-7-9(3)4/h7-9H,6H2,1-5H3/b11-7+,12-10- |
| InChIKey | UZHUJQDTJHRJIQ-LBNSGORRSA-N |
| XLogP | 2.72 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|