About 2-methylpropyl N-(2-methylpropylideneamino)carbamate
2-methylpropyl N-(2-methylpropylideneamino)carbamate (PubChem CID 123852161) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methylpropyl N-(2-methylpropylideneamino)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-(2-methylpropylideneamino)carbamate |
| PubChem CID | 123852161 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-methylpropyl N-(2-methylpropylideneamino)carbamate |
| SMILES | CC(C)C=NNC(=O)OCC(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-7(2)5-10-11-9(12)13-6-8(3)4/h5,7-8H,6H2,1-4H3,(H,11,12) |
| InChIKey | JWDYUTJZQMIPLI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-(2-methylpropylideneamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(2-methylpropylideneamino)carbamate?
The IUPAC name of 2-methylpropyl N-(2-methylpropylideneamino)carbamate (CID 123852161) is 2-methylpropyl N-(2-methylpropylideneamino)carbamate.
What is the SMILES notation for 2-methylpropyl N-(2-methylpropylideneamino)carbamate?
The canonical SMILES for 2-methylpropyl N-(2-methylpropylideneamino)carbamate is CC(C)C=NNC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl N-(2-methylpropylideneamino)carbamate?
The InChIKey is JWDYUTJZQMIPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-7(2)5-10-11-9(12)13-6-8(3)4/h5,7-8H,6H2,1-4H3,(H,11,12).
What are the key properties of 2-methylpropyl N-(2-methylpropylideneamino)carbamate?
2-methylpropyl N-(2-methylpropylideneamino)carbamate has a molecular weight of 186.25 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(2-methylpropylideneamino)carbamate is sourced from PubChem (CID 123852161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).