C26H20F6N4O — CID 172930306
[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methanamine;(NE)-N-[[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 172930306) has the molecular formula C26H20F6N4O and a molecular weight of 518.46 g/mol. Its IUPAC name is [6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methanamine;(NE)-N-[[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | [6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methanamine;(NE)-N-[[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172930306 |
| Molecular Formula | C26H20F6N4O |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methanamine;(NE)-N-[[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | NCc1cccc(-c2cccc(C(F)(F)F)c2)n1.O/N=C/c1cccc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H9F3N2O.C13H11F3N2/c14-13(15,16)10-4-1-3-9(7-10)12-6-2-5-11(18-12)8-17-19;14-13(15,16)10-4-1-3-9(7-10)12-6-2-5-11(8-17)18-12/h1-8,19H;1-7H,8,17H2/b17-8+; |
| InChIKey | NLDTZBFVQQLXJZ-XIDBHWPPSA-N |
| XLogP | 6.80 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|