C15H11F5N2S — CID 21478911
2-(4,4-difluorobut-3-enylsulfanyl)-4-[3-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 21478911) has the molecular formula C15H11F5N2S and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-4-[3-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-[3-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 21478911 |
| Molecular Formula | C15H11F5N2S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-[3-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | FC(F)=CCCSc1nccc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H11F5N2S/c16-13(17)5-2-8-23-14-21-7-6-12(22-14)10-3-1-4-11(9-10)15(18,19)20/h1,3-7,9H,2,8H2 |
| InChIKey | RVQDYUZQHXLLKP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|