C20H19N5O7S2 — CID 172930662
(6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[(Z)-hex-1-en-3-ynyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 172930662) has the molecular formula C20H19N5O7S2 and a molecular weight of 505.53 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[(Z)-hex-1-en-3-ynyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[(Z)-hex-1-en-3-ynyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 172930662 |
| Molecular Formula | C20H19N5O7S2 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[(Z)-hex-1-en-3-ynyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCC#C/C=C\C1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\OCC(=O)O)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C20H19N5O7S2/c1-2-3-4-5-6-10-8-33-18-14(17(29)25(18)15(10)19(30)31)23-16(28)13(24-32-7-12(26)27)11-9-34-20(21)22-11/h5-6,9,14,18H,2,7-8H2,1H3,(H2,21,22)(H,23,28)(H,26,27)(H,30,31)/b6-5-,24-13-/t14-,18-/m1/s1 |
| InChIKey | APXSTVGRNANVMB-PSYJVFGYSA-N |
| XLogP | 0.24 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|