C22H18N6O9S2 — CID 87631645
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[2-(2-nitrophenyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 87631645) has the molecular formula C22H18N6O9S2 and a molecular weight of 574.55 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[2-(2-nitrophenyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[2-(2-nitrophenyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 87631645 |
| Molecular Formula | C22H18N6O9S2 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-[2-(2-nitrophenyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(C(=NOCC(=O)O)C(=O)NC2C(=O)N3C(C(=O)O)=C(C=Cc4ccccc4[N+](=O)[O-])CS[C@@H]23)cs1 |
| InChI | InChI=1S/C22H18N6O9S2/c23-22-24-12(9-39-22)15(26-37-7-14(29)30)18(31)25-16-19(32)27-17(21(33)34)11(8-38-20(16)27)6-5-10-3-1-2-4-13(10)28(35)36/h1-6,9,16,20H,7-8H2,(H2,23,24)(H,25,31)(H,29,30)(H,33,34)/t16?,20-/m0/s1 |
| InChIKey | ADSDQDLVDPJFPZ-FZCLLLDFSA-N |
| XLogP | 0.89 |
| TPSA | 227.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|