C18H25NO11S2 — CID 172930729
[(2S)-2-[(Z)-N-sulfooxy-C-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylcarbonimidoyl]butyl] benzoate (PubChem CID 172930729) has the molecular formula C18H25NO11S2 and a molecular weight of 495.53 g/mol. Its IUPAC name is [(2S)-2-[(Z)-N-sulfooxy-C-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylcarbonimidoyl]butyl] benzoate.
| Compound Name | [(2S)-2-[(Z)-N-sulfooxy-C-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylcarbonimidoyl]butyl] benzoate |
|---|---|
| PubChem CID | 172930729 |
| Molecular Formula | C18H25NO11S2 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [(2S)-2-[(Z)-N-sulfooxy-C-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylcarbonimidoyl]butyl] benzoate |
| SMILES | CC[C@@H](COC(=O)c1ccccc1)/C(=N/OS(=O)(=O)O)S[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H25NO11S2/c1-2-10(9-28-17(24)11-6-4-3-5-7-11)16(19-30-32(25,26)27)31-18-15(23)14(22)13(21)12(8-20)29-18/h3-7,10,12-15,18,20-23H,2,8-9H2,1H3,(H,25,26,27)/b19-16-/t10-,12+,13-,14-,15+,18+/m0/s1 |
| InChIKey | SOSNSVMIXHJRHT-NPHAGLMISA-N |
| XLogP | -0.46 |
| TPSA | 192.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|