C19H27NO11S3 — CID 163122426
[3,4,5-trihydroxy-6-[C-(4-methylsulfinylbutyl)-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl benzoate (PubChem CID 163122426) has the molecular formula C19H27NO11S3 and a molecular weight of 541.62 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[C-(4-methylsulfinylbutyl)-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-trihydroxy-6-[C-(4-methylsulfinylbutyl)-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 163122426 |
| Molecular Formula | C19H27NO11S3 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | [3,4,5-trihydroxy-6-[C-(4-methylsulfinylbutyl)-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl benzoate |
| SMILES | CS(=O)CCCCC(=NOS(=O)(=O)O)SC1OC(COC(=O)c2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C19H27NO11S3/c1-33(25)10-6-5-9-14(20-31-34(26,27)28)32-19-17(23)16(22)15(21)13(30-19)11-29-18(24)12-7-3-2-4-8-12/h2-4,7-8,13,15-17,19,21-23H,5-6,9-11H2,1H3,(H,26,27,28) |
| InChIKey | BZDMKGYBNJMZMW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 189.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|