C21H16N2O5 — CID 172931261
4-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 172931261) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 172931261 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)N/N=C/c2coc3ccccc3c2=O)cc1)CO |
| InChI | InChI=1S/C21H16N2O5/c24-12-17(25)10-7-14-5-8-15(9-6-14)21(27)23-22-11-16-13-28-19-4-2-1-3-18(19)20(16)26/h1-11,13,24H,12H2,(H,23,27)/b10-7+,22-11+ |
| InChIKey | YRJUMDQQBZQBJK-PGTOKJAFSA-N |
| XLogP | 2.13 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|