C26H33N6O7S2+ — CID 172932356
(2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-[4-(1-butyl-2-methylpyrazol-2-ium-4-yl)phenoxy]ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 172932356) has the molecular formula C26H33N6O7S2+ and a molecular weight of 605.72 g/mol. Its IUPAC name is (2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-[4-(1-butyl-2-methylpyrazol-2-ium-4-yl)phenoxy]ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-[4-(1-butyl-2-methylpyrazol-2-ium-4-yl)phenoxy]ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 172932356 |
| Molecular Formula | C26H33N6O7S2+ |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | (2R,3S)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-[2-[4-(1-butyl-2-methylpyrazol-2-ium-4-yl)phenoxy]ethoxyimino]-2-oxopropyl]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CCCCn1cc(-c2ccc(OCCO/N=C(\C(=O)C[C@@H]3C(=O)N(S(=O)(=O)O)[C@@H]3C)c3csc(N)n3)cc2)c[n+]1C |
| InChI | InChI=1S/C26H32N6O7S2/c1-4-5-10-31-15-19(14-30(31)3)18-6-8-20(9-7-18)38-11-12-39-29-24(22-16-40-26(27)28-22)23(33)13-21-17(2)32(25(21)34)41(35,36)37/h6-9,14-17,21H,4-5,10-13H2,1-3H3,(H2-,27,28,35,36,37)/p+1/b29-24-/t17-,21+/m1/s1 |
| InChIKey | ZDYFPTSAIDDXQA-OCHSFNPZSA-O |
| XLogP | 2.23 |
| TPSA | 170.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|