C18H33NO2 — CID 172932390
(4S,5S)-4,5-dimethylhept-6-enal;(NE)-N-[(4S,5S)-4,5-dimethylhept-6-enylidene]hydroxylamine (PubChem CID 172932390) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (4S,5S)-4,5-dimethylhept-6-enal;(NE)-N-[(4S,5S)-4,5-dimethylhept-6-enylidene]hydroxylamine.
| Compound Name | (4S,5S)-4,5-dimethylhept-6-enal;(NE)-N-[(4S,5S)-4,5-dimethylhept-6-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 172932390 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (4S,5S)-4,5-dimethylhept-6-enal;(NE)-N-[(4S,5S)-4,5-dimethylhept-6-enylidene]hydroxylamine |
| SMILES | C=C[C@H](C)[C@@H](C)CC/C=N/O.C=C[C@H](C)[C@@H](C)CCC=O |
| InChI | InChI=1S/C9H17NO.C9H16O/c1-4-8(2)9(3)6-5-7-10-11;1-4-8(2)9(3)6-5-7-10/h4,7-9,11H,1,5-6H2,2-3H3;4,7-9H,1,5-6H2,2-3H3/b10-7+;/t2*8-,9-/m00/s1 |
| InChIKey | JRXGHOWYXAMZIB-OHQROJLYSA-N |
| XLogP | 5.11 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|