C26H26Br3N5O4 — CID 172936573
(2-bromophenyl)hydrazine;methyl 7-bromo-1H-indole-2-carboxylate;methyl (2E)-2-[(2-bromophenyl)hydrazinylidene]propanoate (PubChem CID 172936573) has the molecular formula C26H26Br3N5O4 and a molecular weight of 712.24 g/mol. Its IUPAC name is (2-bromophenyl)hydrazine;methyl 7-bromo-1H-indole-2-carboxylate;methyl (2E)-2-[(2-bromophenyl)hydrazinylidene]propanoate.
| Compound Name | (2-bromophenyl)hydrazine;methyl 7-bromo-1H-indole-2-carboxylate;methyl (2E)-2-[(2-bromophenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 172936573 |
| Molecular Formula | C26H26Br3N5O4 |
| Molecular Weight | 712.24 g/mol |
| Exact Mass | 708.95 |
| IUPAC Name | (2-bromophenyl)hydrazine;methyl 7-bromo-1H-indole-2-carboxylate;methyl (2E)-2-[(2-bromophenyl)hydrazinylidene]propanoate |
| SMILES | COC(=O)/C(C)=N/Nc1ccccc1Br.COC(=O)c1cc2cccc(Br)c2[nH]1.NNc1ccccc1Br |
| InChI | InChI=1S/C10H11BrN2O2.C10H8BrNO2.C6H7BrN2/c1-7(10(14)15-2)12-13-9-6-4-3-5-8(9)11;1-14-10(13)8-5-6-3-2-4-7(11)9(6)12-8;7-5-3-1-2-4-6(5)9-8/h3-6,13H,1-2H3;2-5,12H,1H3;1-4,9H,8H2/b12-7+;; |
| InChIKey | UZCCOPOPCAAGJL-CURPJKDSSA-N |
| XLogP | 6.86 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.24 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|