C11H19N3O — CID 172937619
[(E)-2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylideneamino]urea (PubChem CID 172937619) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is [(E)-2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylideneamino]urea.
| Compound Name | [(E)-2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 172937619 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [(E)-2-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]ethylideneamino]urea |
| SMILES | CC1=CC[C@@H](C/C=N/NC(N)=O)C1(C)C |
| InChI | InChI=1S/C11H19N3O/c1-8-4-5-9(11(8,2)3)6-7-13-14-10(12)15/h4,7,9H,5-6H2,1-3H3,(H3,12,14,15)/b13-7+/t9-/m0/s1 |
| InChIKey | PAZIRMDVWSSYNT-PBJWJZLWSA-N |
| XLogP | 2.02 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|