About [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate
[3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate (PubChem CID 172940400) has the molecular formula C16H29N3O7
and a molecular weight of 375.42 g/mol. Its IUPAC name is [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate |
| PubChem CID | 172940400 |
| Molecular Formula | C16H29N3O7 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate |
| SMILES | C/C=N/OCC(=O)CCCOC(COC(=O)NCC)COC(=O)NCC |
| InChI | InChI=1S/C16H29N3O7/c1-4-17-15(21)24-11-14(12-25-16(22)18-5-2)23-9-7-8-13(20)10-26-19-6-3/h6,14H,4-5,7-12H2,1-3H3,(H,17,21)(H,18,22)/b19-6+ |
| InChIKey | JYAIQVBJVGNMOG-KPSZGOFPSA-N |
| XLogP | 1.24 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate?
The IUPAC name of [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate (CID 172940400) is [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate.
What is the SMILES notation for [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate?
The canonical SMILES for [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate is C/C=N/OCC(=O)CCCOC(COC(=O)NCC)COC(=O)NCC.
What is the InChIKey of [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate?
The InChIKey is JYAIQVBJVGNMOG-KPSZGOFPSA-N. The full InChI is InChI=1S/C16H29N3O7/c1-4-17-15(21)24-11-14(12-25-16(22)18-5-2)23-9-7-8-13(20)10-26-19-6-3/h6,14H,4-5,7-12H2,1-3H3,(H,17,21)(H,18,22)/b19-6+.
What are the key properties of [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate?
[3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate has a molecular weight of 375.42 g/mol, XLogP of 1.24, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(ethylcarbamoyloxy)-2-[5-[(E)-ethylideneamino]oxy-4-oxopentoxy]propyl] N-ethylcarbamate is sourced from PubChem (CID 172940400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).