C27H32F3N5O4S — CID 172942219
2-tert-butyl-N-[(5-ethylsulfonyl-2-pyridinyl)methyl]-1-[[4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2-(trifluoromethyl)phenyl]methyl]-5-methylimidazole-4-carboxamide (PubChem CID 172942219) has the molecular formula C27H32F3N5O4S and a molecular weight of 579.65 g/mol. Its IUPAC name is 2-tert-butyl-N-[(5-ethylsulfonyl-2-pyridinyl)methyl]-1-[[4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2-(trifluoromethyl)phenyl]methyl]-5-methylimidazole-4-carboxamide.
| Compound Name | 2-tert-butyl-N-[(5-ethylsulfonyl-2-pyridinyl)methyl]-1-[[4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2-(trifluoromethyl)phenyl]methyl]-5-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 172942219 |
| Molecular Formula | C27H32F3N5O4S |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 2-tert-butyl-N-[(5-ethylsulfonyl-2-pyridinyl)methyl]-1-[[4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2-(trifluoromethyl)phenyl]methyl]-5-methylimidazole-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2nc(C(C)(C)C)n(Cc3ccc(/C(C)=N\O)cc3C(F)(F)F)c2C)nc1 |
| InChI | InChI=1S/C27H32F3N5O4S/c1-7-40(38,39)21-11-10-20(31-14-21)13-32-24(36)23-17(3)35(25(33-23)26(4,5)6)15-19-9-8-18(16(2)34-37)12-22(19)27(28,29)30/h8-12,14,37H,7,13,15H2,1-6H3,(H,32,36)/b34-16- |
| InChIKey | QNKLJLFSVSGHHL-MJXLXAJKSA-N |
| XLogP | 4.87 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|