C54H94N2O11 — CID 172946254
[2-[3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 172946254) has the molecular formula C54H94N2O11 and a molecular weight of 947.35 g/mol. Its IUPAC name is [2-[3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 172946254 |
| Molecular Formula | C54H94N2O11 |
| Molecular Weight | 947.35 g/mol |
| Exact Mass | 946.69 |
| IUPAC Name | [2-[3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)NC(=O)CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C54H94N2O11/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-53(60)66-47-49(48-67-54(61)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)55-50(57)37-39-62-41-43-64-45-46-65-44-42-63-40-38-56-51(58)35-36-52(56)59/h17-20,35-36,49H,3-16,21-34,37-48H2,1-2H3,(H,55,57)/b19-17-,20-18- |
| InChIKey | KXDYLSKNRGAZAP-CLFAGFIQSA-N |
| XLogP | 11.01 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.35 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|