C16H15FN2O — CID 172947101
(E)-N-[(3-fluorophenyl)methyl]-N'-phenylmethoxyethane-1,2-diimine (PubChem CID 172947101) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is (E)-N-[(3-fluorophenyl)methyl]-N'-phenylmethoxyethane-1,2-diimine.
| Compound Name | (E)-N-[(3-fluorophenyl)methyl]-N'-phenylmethoxyethane-1,2-diimine |
|---|---|
| PubChem CID | 172947101 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (E)-N-[(3-fluorophenyl)methyl]-N'-phenylmethoxyethane-1,2-diimine |
| SMILES | Fc1cccc(C/N=C/C=N/OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H15FN2O/c17-16-8-4-7-15(11-16)12-18-9-10-19-20-13-14-5-2-1-3-6-14/h1-11H,12-13H2/b18-9+,19-10+ |
| InChIKey | QQSXKNKTGUVNEU-VNIJRHKQSA-N |
| XLogP | 3.60 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|