C15H10F5NO — CID 91727496
(E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-phenylethanimine (PubChem CID 91727496) has the molecular formula C15H10F5NO and a molecular weight of 315.24 g/mol. Its IUPAC name is (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-phenylethanimine.
| Compound Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-phenylethanimine |
|---|---|
| PubChem CID | 91727496 |
| Molecular Formula | C15H10F5NO |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-phenylethanimine |
| SMILES | Fc1c(F)c(F)c(CO/N=C/Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C15H10F5NO/c16-11-10(12(17)14(19)15(20)13(11)18)8-22-21-7-6-9-4-2-1-3-5-9/h1-5,7H,6,8H2/b21-7+ |
| InChIKey | XZKVLDDIOBIMHZ-QPSGOUHRSA-N |
| XLogP | 4.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|