C15H11F2NO — CID 11357385
3,5-bis(4-fluorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 11357385) has the molecular formula C15H11F2NO and a molecular weight of 259.26 g/mol. Its IUPAC name is 3,5-bis(4-fluorophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3,5-bis(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 11357385 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3,5-bis(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C2=NOC(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C15H11F2NO/c16-12-5-1-10(2-6-12)14-9-15(19-18-14)11-3-7-13(17)8-4-11/h1-8,15H,9H2 |
| InChIKey | KANCJHOTYIMBRQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |