C39H78N2O5 — CID 172948347
[3-(2-ethylhexoxy)-2,2-bis(2-ethylhexoxymethyl)propyl] 5-(4-methylpiperazin-1-yl)pentanoate (PubChem CID 172948347) has the molecular formula C39H78N2O5 and a molecular weight of 655.06 g/mol. Its IUPAC name is [3-(2-ethylhexoxy)-2,2-bis(2-ethylhexoxymethyl)propyl] 5-(4-methylpiperazin-1-yl)pentanoate.
| Compound Name | [3-(2-ethylhexoxy)-2,2-bis(2-ethylhexoxymethyl)propyl] 5-(4-methylpiperazin-1-yl)pentanoate |
|---|---|
| PubChem CID | 172948347 |
| Molecular Formula | C39H78N2O5 |
| Molecular Weight | 655.06 g/mol |
| Exact Mass | 654.59 |
| IUPAC Name | [3-(2-ethylhexoxy)-2,2-bis(2-ethylhexoxymethyl)propyl] 5-(4-methylpiperazin-1-yl)pentanoate |
| SMILES | CCCCC(CC)COCC(COCC(CC)CCCC)(COCC(CC)CCCC)COC(=O)CCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C39H78N2O5/c1-8-14-19-35(11-4)28-43-31-39(32-44-29-36(12-5)20-15-9-2,33-45-30-37(13-6)21-16-10-3)34-46-38(42)22-17-18-23-41-26-24-40(7)25-27-41/h35-37H,8-34H2,1-7H3 |
| InChIKey | WPCMJIJHQNYPMI-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.06 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|