C39H72N2O8 — CID 172948346
[2,2-bis(2-ethylhexanoyloxymethyl)-3-[5-(4-methylpiperazin-1-yl)pentanoyloxy]propyl] 2-ethylhexanoate (PubChem CID 172948346) has the molecular formula C39H72N2O8 and a molecular weight of 697.01 g/mol. Its IUPAC name is [2,2-bis(2-ethylhexanoyloxymethyl)-3-[5-(4-methylpiperazin-1-yl)pentanoyloxy]propyl] 2-ethylhexanoate.
| Compound Name | [2,2-bis(2-ethylhexanoyloxymethyl)-3-[5-(4-methylpiperazin-1-yl)pentanoyloxy]propyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 172948346 |
| Molecular Formula | C39H72N2O8 |
| Molecular Weight | 697.01 g/mol |
| Exact Mass | 696.53 |
| IUPAC Name | [2,2-bis(2-ethylhexanoyloxymethyl)-3-[5-(4-methylpiperazin-1-yl)pentanoyloxy]propyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC(COC(=O)CCCCN1CCN(C)CC1)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC |
| InChI | InChI=1S/C39H72N2O8/c1-8-14-19-32(11-4)36(43)47-29-39(30-48-37(44)33(12-5)20-15-9-2,31-49-38(45)34(13-6)21-16-10-3)28-46-35(42)22-17-18-23-41-26-24-40(7)25-27-41/h32-34H,8-31H2,1-7H3 |
| InChIKey | RRSCANWWNNNSIS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.01 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|