C19H20I3NO4 — CID 172949121
(1E)-3-hydroxy-1-methoxyimino-1-[2-[(2-methylphenoxy)methyl]phenyl]propan-2-one;iodoform (PubChem CID 172949121) has the molecular formula C19H20I3NO4 and a molecular weight of 707.08 g/mol. Its IUPAC name is (1E)-3-hydroxy-1-methoxyimino-1-[2-[(2-methylphenoxy)methyl]phenyl]propan-2-one;iodoform.
| Compound Name | (1E)-3-hydroxy-1-methoxyimino-1-[2-[(2-methylphenoxy)methyl]phenyl]propan-2-one;iodoform |
|---|---|
| PubChem CID | 172949121 |
| Molecular Formula | C19H20I3NO4 |
| Molecular Weight | 707.08 g/mol |
| Exact Mass | 706.85 |
| IUPAC Name | (1E)-3-hydroxy-1-methoxyimino-1-[2-[(2-methylphenoxy)methyl]phenyl]propan-2-one;iodoform |
| SMILES | CO/N=C(/C(=O)CO)c1ccccc1COc1ccccc1C.IC(I)I |
| InChI | InChI=1S/C18H19NO4.CHI3/c1-13-7-3-6-10-17(13)23-12-14-8-4-5-9-15(14)18(19-22-2)16(21)11-20;2-1(3)4/h3-10,20H,11-12H2,1-2H3;1H/b19-18+; |
| InChIKey | IOHKHHOQDOTCKM-LTRPLHCISA-N |
| XLogP | 5.06 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.08 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|