C32H33F3N6O6 — CID 172950599
2,6-difluoropyridine;(2E)-2-[2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;(2E)-2-[2-(hydroxymethyl)phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 172950599) has the molecular formula C32H33F3N6O6 and a molecular weight of 654.65 g/mol. Its IUPAC name is 2,6-difluoropyridine;(2E)-2-[2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;(2E)-2-[2-(hydroxymethyl)phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2,6-difluoropyridine;(2E)-2-[2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;(2E)-2-[2-(hydroxymethyl)phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 172950599 |
| Molecular Formula | C32H33F3N6O6 |
| Molecular Weight | 654.65 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 2,6-difluoropyridine;(2E)-2-[2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;(2E)-2-[2-(hydroxymethyl)phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1CO.CNC(=O)/C(=N/OC)c1ccccc1COc1cccc(F)n1.Fc1cccc(F)n1 |
| InChI | InChI=1S/C16H16FN3O3.C11H14N2O3.C5H3F2N/c1-18-16(21)15(20-22-2)12-7-4-3-6-11(12)10-23-14-9-5-8-13(17)19-14;1-12-11(15)10(13-16-2)9-6-4-3-5-8(9)7-14;6-4-2-1-3-5(7)8-4/h3-9H,10H2,1-2H3,(H,18,21);3-6,14H,7H2,1-2H3,(H,12,15);1-3H/b20-15+;13-10+; |
| InChIKey | GYIHIEFZSRCSRX-JJQCNIIASA-N |
| XLogP | 3.53 |
| TPSA | 156.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|