C18H21BN3O4 — CID 91390445
CID 91390445 (PubChem CID 91390445) has the molecular formula C18H21BN3O4 and a molecular weight of 354.20 g/mol.
| Compound Name | CID 91390445 |
|---|---|
| PubChem CID | 91390445 |
| Molecular Formula | C18H21BN3O4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | — |
| SMILES | C[B]COc1cccc(OCc2ccccc2/C(=N\OC)C(=O)NC)n1 |
| InChI | InChI=1S/C18H21BN3O4/c1-19-12-26-16-10-6-9-15(21-16)25-11-13-7-4-5-8-14(13)17(22-24-3)18(23)20-2/h4-10H,11-12H2,1-3H3,(H,20,23)/b22-17+ |
| InChIKey | BZCJWJKGPHAZJC-OQKWZONESA-N |
| XLogP | 1.85 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|