C42H41ClF2N4O3 — CID 172952943
2-ethylbutanoyl chloride;4-[2-(3-fluorophenyl)ethynyl]-N'-hydroxybenzenecarboximidamide;3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-pentan-3-yl-1,2,4-oxadiazole (PubChem CID 172952943) has the molecular formula C42H41ClF2N4O3 and a molecular weight of 723.26 g/mol. Its IUPAC name is 2-ethylbutanoyl chloride;4-[2-(3-fluorophenyl)ethynyl]-N'-hydroxybenzenecarboximidamide;3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-pentan-3-yl-1,2,4-oxadiazole.
| Compound Name | 2-ethylbutanoyl chloride;4-[2-(3-fluorophenyl)ethynyl]-N'-hydroxybenzenecarboximidamide;3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-pentan-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 172952943 |
| Molecular Formula | C42H41ClF2N4O3 |
| Molecular Weight | 723.26 g/mol |
| Exact Mass | 722.28 |
| IUPAC Name | 2-ethylbutanoyl chloride;4-[2-(3-fluorophenyl)ethynyl]-N'-hydroxybenzenecarboximidamide;3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-pentan-3-yl-1,2,4-oxadiazole |
| SMILES | CCC(CC)C(=O)Cl.CCC(CC)c1nc(-c2ccc(C#Cc3cccc(F)c3)cc2)no1.N/C(=N\O)c1ccc(C#Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H19FN2O.C15H11FN2O.C6H11ClO/c1-3-17(4-2)21-23-20(24-25-21)18-12-10-15(11-13-18)8-9-16-6-5-7-19(22)14-16;16-14-3-1-2-12(10-14)5-4-11-6-8-13(9-7-11)15(17)18-19;1-3-5(4-2)6(7)8/h5-7,10-14,17H,3-4H2,1-2H3;1-3,6-10,19H,(H2,17,18);5H,3-4H2,1-2H3 |
| InChIKey | HXHLYOWJJQJNQY-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 114.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.26 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|