C20H17FN2O — CID 71618210
5-tert-butyl-3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-1,2,4-oxadiazole (PubChem CID 71618210) has the molecular formula C20H17FN2O and a molecular weight of 320.37 g/mol. Its IUPAC name is 5-tert-butyl-3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-tert-butyl-3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71618210 |
| Molecular Formula | C20H17FN2O |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 5-tert-butyl-3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-1,2,4-oxadiazole |
| SMILES | CC(C)(C)c1nc(-c2ccc(C#Cc3cccc(F)c3)cc2)no1 |
| InChI | InChI=1S/C20H17FN2O/c1-20(2,3)19-22-18(23-24-19)16-11-9-14(10-12-16)7-8-15-5-4-6-17(21)13-15/h4-6,9-13H,1-3H3 |
| InChIKey | QKSSKPRDTBOUDB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|