C21H17FN2O2 — CID 71618338
3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-(oxan-4-yl)-1,2,4-oxadiazole (PubChem CID 71618338) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-(oxan-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71618338 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[4-[2-(3-fluorophenyl)ethynyl]phenyl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
| SMILES | Fc1cccc(C#Cc2ccc(-c3noc(C4CCOCC4)n3)cc2)c1 |
| InChI | InChI=1S/C21H17FN2O2/c22-19-3-1-2-16(14-19)5-4-15-6-8-17(9-7-15)20-23-21(26-24-20)18-10-12-25-13-11-18/h1-3,6-9,14,18H,10-13H2 |
| InChIKey | IKWQEJQIJODQPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|